C12H18BrNO2 — CID 116915074
1-bromo-1-(4,5-dimethoxy-2-methylphenyl)-N,N-dimethylmethanamine (PubChem CID 116915074) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 1-bromo-1-(4,5-dimethoxy-2-methylphenyl)-N,N-dimethylmethanamine.
| Compound Name | 1-bromo-1-(4,5-dimethoxy-2-methylphenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 116915074 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-bromo-1-(4,5-dimethoxy-2-methylphenyl)-N,N-dimethylmethanamine |
| SMILES | COc1cc(C)c(C(Br)N(C)C)cc1OC |
| InChI | InChI=1S/C12H18BrNO2/c1-8-6-10(15-4)11(16-5)7-9(8)12(13)14(2)3/h6-7,12H,1-5H3 |
| InChIKey | AVTKATAQFQBSNP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|