C12H18BrNO3 — CID 116915081
1-bromo-N,N-dimethyl-1-(2,4,6-trimethoxyphenyl)methanamine (PubChem CID 116915081) has the molecular formula C12H18BrNO3 and a molecular weight of 304.18 g/mol. Its IUPAC name is 1-bromo-N,N-dimethyl-1-(2,4,6-trimethoxyphenyl)methanamine.
| Compound Name | 1-bromo-N,N-dimethyl-1-(2,4,6-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 116915081 |
| Molecular Formula | C12H18BrNO3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-bromo-N,N-dimethyl-1-(2,4,6-trimethoxyphenyl)methanamine |
| SMILES | COc1cc(OC)c(C(Br)N(C)C)c(OC)c1 |
| InChI | InChI=1S/C12H18BrNO3/c1-14(2)12(13)11-9(16-4)6-8(15-3)7-10(11)17-5/h6-7,12H,1-5H3 |
| InChIKey | QGSMCEFILTWXHG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|