C17H27BrO3 — CID 82990059
2-(1-bromo-2-propylpentyl)-1,3,5-trimethoxybenzene (PubChem CID 82990059) has the molecular formula C17H27BrO3 and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-(1-bromo-2-propylpentyl)-1,3,5-trimethoxybenzene.
| Compound Name | 2-(1-bromo-2-propylpentyl)-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 82990059 |
| Molecular Formula | C17H27BrO3 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-(1-bromo-2-propylpentyl)-1,3,5-trimethoxybenzene |
| SMILES | CCCC(CCC)C(Br)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C17H27BrO3/c1-6-8-12(9-7-2)17(18)16-14(20-4)10-13(19-3)11-15(16)21-5/h10-12,17H,6-9H2,1-5H3 |
| InChIKey | DXYDWMJMPYEBNT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|