C14H19BrF2O — CID 114753540
2-(1-bromoheptyl)-1,3-difluoro-5-methoxybenzene (PubChem CID 114753540) has the molecular formula C14H19BrF2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 2-(1-bromoheptyl)-1,3-difluoro-5-methoxybenzene.
| Compound Name | 2-(1-bromoheptyl)-1,3-difluoro-5-methoxybenzene |
|---|---|
| PubChem CID | 114753540 |
| Molecular Formula | C14H19BrF2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-(1-bromoheptyl)-1,3-difluoro-5-methoxybenzene |
| SMILES | CCCCCCC(Br)c1c(F)cc(OC)cc1F |
| InChI | InChI=1S/C14H19BrF2O/c1-3-4-5-6-7-11(15)14-12(16)8-10(18-2)9-13(14)17/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | XZTNXBXBJRIRMI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|