C14H20N2O3 — CID 116909948
3-(dimethylamino)-3-(2,4,6-trimethoxyphenyl)propanenitrile (PubChem CID 116909948) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-(dimethylamino)-3-(2,4,6-trimethoxyphenyl)propanenitrile.
| Compound Name | 3-(dimethylamino)-3-(2,4,6-trimethoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 116909948 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-(dimethylamino)-3-(2,4,6-trimethoxyphenyl)propanenitrile |
| SMILES | COc1cc(OC)c(C(CC#N)N(C)C)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-16(2)11(6-7-15)14-12(18-4)8-10(17-3)9-13(14)19-5/h8-9,11H,6H2,1-5H3 |
| InChIKey | APIQBKQSTIHOSB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |