C12H16N2O3 — CID 115131011
2-[(2,4,6-trimethoxyphenyl)methylamino]acetonitrile (PubChem CID 115131011) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[(2,4,6-trimethoxyphenyl)methylamino]acetonitrile.
| Compound Name | 2-[(2,4,6-trimethoxyphenyl)methylamino]acetonitrile |
|---|---|
| PubChem CID | 115131011 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-[(2,4,6-trimethoxyphenyl)methylamino]acetonitrile |
| SMILES | COc1cc(OC)c(CNCC#N)c(OC)c1 |
| InChI | InChI=1S/C12H16N2O3/c1-15-9-6-11(16-2)10(8-14-5-4-13)12(7-9)17-3/h6-7,14H,5,8H2,1-3H3 |
| InChIKey | NVORCGNWKYKVFN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|