C11H17NO3S — CID 115227955
[(2,4,6-trimethoxyphenyl)methylamino]methanethiol (PubChem CID 115227955) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is [(2,4,6-trimethoxyphenyl)methylamino]methanethiol.
| Compound Name | [(2,4,6-trimethoxyphenyl)methylamino]methanethiol |
|---|---|
| PubChem CID | 115227955 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | [(2,4,6-trimethoxyphenyl)methylamino]methanethiol |
| SMILES | COc1cc(OC)c(CNCS)c(OC)c1 |
| InChI | InChI=1S/C11H17NO3S/c1-13-8-4-10(14-2)9(6-12-7-16)11(5-8)15-3/h4-5,12,16H,6-7H2,1-3H3 |
| InChIKey | SQQZZFKGYLJROJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|