C15H19NO3S — CID 43090897
1-thiophen-2-yl-N-[(2,4,6-trimethoxyphenyl)methyl]methanamine (PubChem CID 43090897) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-thiophen-2-yl-N-[(2,4,6-trimethoxyphenyl)methyl]methanamine.
| Compound Name | 1-thiophen-2-yl-N-[(2,4,6-trimethoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 43090897 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 1-thiophen-2-yl-N-[(2,4,6-trimethoxyphenyl)methyl]methanamine |
| SMILES | COc1cc(OC)c(CNCc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C15H19NO3S/c1-17-11-7-14(18-2)13(15(8-11)19-3)10-16-9-12-5-4-6-20-12/h4-8,16H,9-10H2,1-3H3 |
| InChIKey | DXTDSQKPLDAJLS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |