C16H21NO3S — CID 62599304
2-(2,6-dimethoxy-4-methylphenoxy)-N-(thiophen-2-ylmethyl)ethanamine (PubChem CID 62599304) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-(2,6-dimethoxy-4-methylphenoxy)-N-(thiophen-2-ylmethyl)ethanamine.
| Compound Name | 2-(2,6-dimethoxy-4-methylphenoxy)-N-(thiophen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62599304 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(2,6-dimethoxy-4-methylphenoxy)-N-(thiophen-2-ylmethyl)ethanamine |
| SMILES | COc1cc(C)cc(OC)c1OCCNCc1cccs1 |
| InChI | InChI=1S/C16H21NO3S/c1-12-9-14(18-2)16(15(10-12)19-3)20-7-6-17-11-13-5-4-8-21-13/h4-5,8-10,17H,6-7,11H2,1-3H3 |
| InChIKey | WAZHJJXYZUTYOW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|