C13H15NO4S2 — CID 19682467
2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 19682467) has the molecular formula C13H15NO4S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 19682467 |
| Molecular Formula | C13H15NO4S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2,4-dimethoxy-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C13H15NO4S2/c1-17-10-5-6-13(12(8-10)18-2)20(15,16)14-9-11-4-3-7-19-11/h3-8,14H,9H2,1-2H3 |
| InChIKey | OIZLFTRRQUNCSM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |