C15H19NO4S2 — CID 110733479
2,4-dimethoxy-N-methyl-N-(2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 110733479) has the molecular formula C15H19NO4S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2,4-dimethoxy-N-methyl-N-(2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-methyl-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110733479 |
| Molecular Formula | C15H19NO4S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2,4-dimethoxy-N-methyl-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CCc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C15H19NO4S2/c1-16(9-8-13-5-4-10-21-13)22(17,18)15-7-6-12(19-2)11-14(15)20-3/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | ZYYZPIFSYDDLHI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |