C12H14BrNO4S2 — CID 79488126
2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-thiophen-2-ylethyl)furan-3-sulfonamide (PubChem CID 79488126) has the molecular formula C12H14BrNO4S2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-thiophen-2-ylethyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-thiophen-2-ylethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 79488126 |
| Molecular Formula | C12H14BrNO4S2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | 2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-thiophen-2-ylethyl)furan-3-sulfonamide |
| SMILES | CN(CCc1cccs1)S(=O)(=O)c1cc(CO)oc1Br |
| InChI | InChI=1S/C12H14BrNO4S2/c1-14(5-4-10-3-2-6-19-10)20(16,17)11-7-9(8-15)18-12(11)13/h2-3,6-7,15H,4-5,8H2,1H3 |
| InChIKey | GHQKMWGZZVHPOL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |