C9H14BrNO6S2 — CID 79864357
2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-methylsulfonylethyl)furan-3-sulfonamide (PubChem CID 79864357) has the molecular formula C9H14BrNO6S2 and a molecular weight of 376.25 g/mol. Its IUPAC name is 2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-methylsulfonylethyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-methylsulfonylethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 79864357 |
| Molecular Formula | C9H14BrNO6S2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | 2-bromo-5-(hydroxymethyl)-N-methyl-N-(2-methylsulfonylethyl)furan-3-sulfonamide |
| SMILES | CN(CCS(C)(=O)=O)S(=O)(=O)c1cc(CO)oc1Br |
| InChI | InChI=1S/C9H14BrNO6S2/c1-11(3-4-18(2,13)14)19(15,16)8-5-7(6-12)17-9(8)10/h5,12H,3-4,6H2,1-2H3 |
| InChIKey | RTOWKZZFNZVIIY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |