C12H21BrN2O4S — CID 103192203
2-bromo-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-5-(hydroxymethyl)furan-3-sulfonamide (PubChem CID 103192203) has the molecular formula C12H21BrN2O4S and a molecular weight of 369.28 g/mol. Its IUPAC name is 2-bromo-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-5-(hydroxymethyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-5-(hydroxymethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 103192203 |
| Molecular Formula | C12H21BrN2O4S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-bromo-N-[1-(dimethylamino)propan-2-yl]-N-ethyl-5-(hydroxymethyl)furan-3-sulfonamide |
| SMILES | CCN(C(C)CN(C)C)S(=O)(=O)c1cc(CO)oc1Br |
| InChI | InChI=1S/C12H21BrN2O4S/c1-5-15(9(2)7-14(3)4)20(17,18)11-6-10(8-16)19-12(11)13/h6,9,16H,5,7-8H2,1-4H3 |
| InChIKey | CCUWQKGAFFPIRQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |