C12H17BrClNO4S2 — CID 114363680
2-bromo-5-(chloromethyl)-N,3-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 114363680) has the molecular formula C12H17BrClNO4S2 and a molecular weight of 418.76 g/mol. Its IUPAC name is 2-bromo-5-(chloromethyl)-N,3-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 2-bromo-5-(chloromethyl)-N,3-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114363680 |
| Molecular Formula | C12H17BrClNO4S2 |
| Molecular Weight | 418.76 g/mol |
| Exact Mass | 416.95 |
| IUPAC Name | 2-bromo-5-(chloromethyl)-N,3-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | Cc1cc(CCl)cc(S(=O)(=O)N(C)CCS(C)(=O)=O)c1Br |
| InChI | InChI=1S/C12H17BrClNO4S2/c1-9-6-10(8-14)7-11(12(9)13)21(18,19)15(2)4-5-20(3,16)17/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | SFWQVICLYPAHSF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.76 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|