C14H19BrClNO2S — CID 114363633
2-bromo-5-(chloromethyl)-N-(cyclopropylmethyl)-N-ethyl-3-methylbenzenesulfonamide (PubChem CID 114363633) has the molecular formula C14H19BrClNO2S and a molecular weight of 380.74 g/mol. Its IUPAC name is 2-bromo-5-(chloromethyl)-N-(cyclopropylmethyl)-N-ethyl-3-methylbenzenesulfonamide.
| Compound Name | 2-bromo-5-(chloromethyl)-N-(cyclopropylmethyl)-N-ethyl-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114363633 |
| Molecular Formula | C14H19BrClNO2S |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 2-bromo-5-(chloromethyl)-N-(cyclopropylmethyl)-N-ethyl-3-methylbenzenesulfonamide |
| SMILES | CCN(CC1CC1)S(=O)(=O)c1cc(CCl)cc(C)c1Br |
| InChI | InChI=1S/C14H19BrClNO2S/c1-3-17(9-11-4-5-11)20(18,19)13-7-12(8-16)6-10(2)14(13)15/h6-7,11H,3-5,8-9H2,1-2H3 |
| InChIKey | KRUCMWPKEWWMGB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|