C15H19Br2NO2S — CID 81435152
2,5-dibromo-N,N-bis(cyclopropylmethyl)-4-methylbenzenesulfonamide (PubChem CID 81435152) has the molecular formula C15H19Br2NO2S and a molecular weight of 437.20 g/mol. Its IUPAC name is 2,5-dibromo-N,N-bis(cyclopropylmethyl)-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N,N-bis(cyclopropylmethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81435152 |
| Molecular Formula | C15H19Br2NO2S |
| Molecular Weight | 437.20 g/mol |
| Exact Mass | 434.95 |
| IUPAC Name | 2,5-dibromo-N,N-bis(cyclopropylmethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)N(CC2CC2)CC2CC2)cc1Br |
| InChI | InChI=1S/C15H19Br2NO2S/c1-10-6-14(17)15(7-13(10)16)21(19,20)18(8-11-2-3-11)9-12-4-5-12/h6-7,11-12H,2-5,8-9H2,1H3 |
| InChIKey | DDZANUUKYAUCSW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.20 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |