C11H15Br2NO2S — CID 50876814
2,4-dibromo-N,N-diethyl-5-methylbenzenesulfonamide (PubChem CID 50876814) has the molecular formula C11H15Br2NO2S and a molecular weight of 385.12 g/mol. Its IUPAC name is 2,4-dibromo-N,N-diethyl-5-methylbenzenesulfonamide.
| Compound Name | 2,4-dibromo-N,N-diethyl-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 50876814 |
| Molecular Formula | C11H15Br2NO2S |
| Molecular Weight | 385.12 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 2,4-dibromo-N,N-diethyl-5-methylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C)c(Br)cc1Br |
| InChI | InChI=1S/C11H15Br2NO2S/c1-4-14(5-2)17(15,16)11-6-8(3)9(12)7-10(11)13/h6-7H,4-5H2,1-3H3 |
| InChIKey | XGQQPCUUVGETDD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.12 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |