C13H18Br2N2O3S — CID 80711575
2-[butyl-(2,5-dibromo-4-methylphenyl)sulfonylamino]acetamide (PubChem CID 80711575) has the molecular formula C13H18Br2N2O3S and a molecular weight of 442.17 g/mol. Its IUPAC name is 2-[butyl-(2,5-dibromo-4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | 2-[butyl-(2,5-dibromo-4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 80711575 |
| Molecular Formula | C13H18Br2N2O3S |
| Molecular Weight | 442.17 g/mol |
| Exact Mass | 439.94 |
| IUPAC Name | 2-[butyl-(2,5-dibromo-4-methylphenyl)sulfonylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)S(=O)(=O)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C13H18Br2N2O3S/c1-3-4-5-17(8-13(16)18)21(19,20)12-7-10(14)9(2)6-11(12)15/h6-7H,3-5,8H2,1-2H3,(H2,16,18) |
| InChIKey | OPCLNBNVSHMXGQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |