C12H19N3O5S2 — CID 55702921
2-[butyl-(3-sulfamoylphenyl)sulfonylamino]acetamide (PubChem CID 55702921) has the molecular formula C12H19N3O5S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[butyl-(3-sulfamoylphenyl)sulfonylamino]acetamide.
| Compound Name | 2-[butyl-(3-sulfamoylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 55702921 |
| Molecular Formula | C12H19N3O5S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-[butyl-(3-sulfamoylphenyl)sulfonylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H19N3O5S2/c1-2-3-7-15(9-12(13)16)22(19,20)11-6-4-5-10(8-11)21(14,17)18/h4-6,8H,2-3,7,9H2,1H3,(H2,13,16)(H2,14,17,18) |
| InChIKey | KALPNCZQEPOIDE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |