C11H18N2O4S2 — CID 43269074
3-N-ethyl-3-N-propylbenzene-1,3-disulfonamide (PubChem CID 43269074) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-N-ethyl-3-N-propylbenzene-1,3-disulfonamide.
| Compound Name | 3-N-ethyl-3-N-propylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 43269074 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-N-ethyl-3-N-propylbenzene-1,3-disulfonamide |
| SMILES | CCCN(CC)S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-3-8-13(4-2)19(16,17)11-7-5-6-10(9-11)18(12,14)15/h5-7,9H,3-4,8H2,1-2H3,(H2,12,14,15) |
| InChIKey | CXNDTCIJAAXXLY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |