C11H18N2O5S2 — CID 61384378
3-N-ethyl-3-N-(2-methoxyethyl)benzene-1,3-disulfonamide (PubChem CID 61384378) has the molecular formula C11H18N2O5S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-N-ethyl-3-N-(2-methoxyethyl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-ethyl-3-N-(2-methoxyethyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 61384378 |
| Molecular Formula | C11H18N2O5S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 3-N-ethyl-3-N-(2-methoxyethyl)benzene-1,3-disulfonamide |
| SMILES | CCN(CCOC)S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H18N2O5S2/c1-3-13(7-8-18-2)20(16,17)11-6-4-5-10(9-11)19(12,14)15/h4-6,9H,3,7-8H2,1-2H3,(H2,12,14,15) |
| InChIKey | QNVALUJIDMPOGK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |