C12H19BrN2O4S — CID 115328826
3-amino-4-bromo-N,N-bis(2-methoxyethyl)benzenesulfonamide (PubChem CID 115328826) has the molecular formula C12H19BrN2O4S and a molecular weight of 367.27 g/mol. Its IUPAC name is 3-amino-4-bromo-N,N-bis(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 3-amino-4-bromo-N,N-bis(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115328826 |
| Molecular Formula | C12H19BrN2O4S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 3-amino-4-bromo-N,N-bis(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C12H19BrN2O4S/c1-18-7-5-15(6-8-19-2)20(16,17)10-3-4-11(13)12(14)9-10/h3-4,9H,5-8,14H2,1-2H3 |
| InChIKey | QHNVHYBGPWARFZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|