C12H18Br2N2O4S — CID 54465252
4-amino-3,5-dibromo-N,N-bis(2-methoxyethyl)benzenesulfonamide (PubChem CID 54465252) has the molecular formula C12H18Br2N2O4S and a molecular weight of 446.16 g/mol. Its IUPAC name is 4-amino-3,5-dibromo-N,N-bis(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 4-amino-3,5-dibromo-N,N-bis(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54465252 |
| Molecular Formula | C12H18Br2N2O4S |
| Molecular Weight | 446.16 g/mol |
| Exact Mass | 443.94 |
| IUPAC Name | 4-amino-3,5-dibromo-N,N-bis(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1cc(Br)c(N)c(Br)c1 |
| InChI | InChI=1S/C12H18Br2N2O4S/c1-19-5-3-16(4-6-20-2)21(17,18)9-7-10(13)12(15)11(14)8-9/h7-8H,3-6,15H2,1-2H3 |
| InChIKey | XEJOUMZGLGETIF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|