C12H20BrN3O4S — CID 62157005
2-amino-5-bromo-N-(2-methoxyethyl)-N-(3-methoxypropyl)pyridine-3-sulfonamide (PubChem CID 62157005) has the molecular formula C12H20BrN3O4S and a molecular weight of 382.28 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(2-methoxyethyl)-N-(3-methoxypropyl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-bromo-N-(2-methoxyethyl)-N-(3-methoxypropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62157005 |
| Molecular Formula | C12H20BrN3O4S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 2-amino-5-bromo-N-(2-methoxyethyl)-N-(3-methoxypropyl)pyridine-3-sulfonamide |
| SMILES | COCCCN(CCOC)S(=O)(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C12H20BrN3O4S/c1-19-6-3-4-16(5-7-20-2)21(17,18)11-8-10(13)9-15-12(11)14/h8-9H,3-7H2,1-2H3,(H2,14,15) |
| InChIKey | NGZSDOLETYGJNF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|