C12H20BrN3O3S — CID 62157414
5-bromo-N-ethyl-2-(ethylamino)-N-(2-methoxyethyl)pyridine-3-sulfonamide (PubChem CID 62157414) has the molecular formula C12H20BrN3O3S and a molecular weight of 366.28 g/mol. Its IUPAC name is 5-bromo-N-ethyl-2-(ethylamino)-N-(2-methoxyethyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-ethyl-2-(ethylamino)-N-(2-methoxyethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62157414 |
| Molecular Formula | C12H20BrN3O3S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 5-bromo-N-ethyl-2-(ethylamino)-N-(2-methoxyethyl)pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)N(CC)CCOC |
| InChI | InChI=1S/C12H20BrN3O3S/c1-4-14-12-11(8-10(13)9-15-12)20(17,18)16(5-2)6-7-19-3/h8-9H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | DZSIEGUCMMNNBS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |