C13H22BrN3O3S — CID 63690095
5-bromo-N-(2-ethoxyethyl)-N-ethyl-2-(ethylamino)pyridine-3-sulfonamide (PubChem CID 63690095) has the molecular formula C13H22BrN3O3S and a molecular weight of 380.31 g/mol. Its IUPAC name is 5-bromo-N-(2-ethoxyethyl)-N-ethyl-2-(ethylamino)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-(2-ethoxyethyl)-N-ethyl-2-(ethylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63690095 |
| Molecular Formula | C13H22BrN3O3S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 5-bromo-N-(2-ethoxyethyl)-N-ethyl-2-(ethylamino)pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)N(CC)CCOCC |
| InChI | InChI=1S/C13H22BrN3O3S/c1-4-15-13-12(9-11(14)10-16-13)21(18,19)17(5-2)7-8-20-6-3/h9-10H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | JFDITRGBDQFOAM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|