C11H15BrN4O2S — CID 55044408
5-bromo-N-(2-cyanoethyl)-2-(ethylamino)-N-methylpyridine-3-sulfonamide (PubChem CID 55044408) has the molecular formula C11H15BrN4O2S and a molecular weight of 347.24 g/mol. Its IUPAC name is 5-bromo-N-(2-cyanoethyl)-2-(ethylamino)-N-methylpyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-(2-cyanoethyl)-2-(ethylamino)-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55044408 |
| Molecular Formula | C11H15BrN4O2S |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 5-bromo-N-(2-cyanoethyl)-2-(ethylamino)-N-methylpyridine-3-sulfonamide |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)N(C)CCC#N |
| InChI | InChI=1S/C11H15BrN4O2S/c1-3-14-11-10(7-9(12)8-15-11)19(17,18)16(2)6-4-5-13/h7-8H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | UCUHKDYAPSNHRZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |