C11H19BrN4O2S — CID 63727213
5-bromo-N-[2-(dimethylamino)ethyl]-N-methyl-2-(methylamino)pyridine-3-sulfonamide (PubChem CID 63727213) has the molecular formula C11H19BrN4O2S and a molecular weight of 351.27 g/mol. Its IUPAC name is 5-bromo-N-[2-(dimethylamino)ethyl]-N-methyl-2-(methylamino)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-[2-(dimethylamino)ethyl]-N-methyl-2-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63727213 |
| Molecular Formula | C11H19BrN4O2S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 5-bromo-N-[2-(dimethylamino)ethyl]-N-methyl-2-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(Br)cc1S(=O)(=O)N(C)CCN(C)C |
| InChI | InChI=1S/C11H19BrN4O2S/c1-13-11-10(7-9(12)8-14-11)19(17,18)16(4)6-5-15(2)3/h7-8H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | APGOCTWGBABTLA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |