C9H14BrN3O3S — CID 62145501
5-bromo-N-(2-hydroxyethyl)-N-methyl-2-(methylamino)pyridine-3-sulfonamide (PubChem CID 62145501) has the molecular formula C9H14BrN3O3S and a molecular weight of 324.20 g/mol. Its IUPAC name is 5-bromo-N-(2-hydroxyethyl)-N-methyl-2-(methylamino)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-(2-hydroxyethyl)-N-methyl-2-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62145501 |
| Molecular Formula | C9H14BrN3O3S |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 5-bromo-N-(2-hydroxyethyl)-N-methyl-2-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(Br)cc1S(=O)(=O)N(C)CCO |
| InChI | InChI=1S/C9H14BrN3O3S/c1-11-9-8(5-7(10)6-12-9)17(15,16)13(2)3-4-14/h5-6,14H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | XFZJTIGZTNNZKC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |