C12H14BrN5O2S — CID 62164035
5-bromo-N,N-bis(cyanomethyl)-2-(propylamino)pyridine-3-sulfonamide (PubChem CID 62164035) has the molecular formula C12H14BrN5O2S and a molecular weight of 372.25 g/mol. Its IUPAC name is 5-bromo-N,N-bis(cyanomethyl)-2-(propylamino)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N,N-bis(cyanomethyl)-2-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62164035 |
| Molecular Formula | C12H14BrN5O2S |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 5-bromo-N,N-bis(cyanomethyl)-2-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ncc(Br)cc1S(=O)(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C12H14BrN5O2S/c1-2-5-16-12-11(8-10(13)9-17-12)21(19,20)18(6-3-14)7-4-15/h8-9H,2,5-7H2,1H3,(H,16,17) |
| InChIKey | SPBYRKGMZGUSRW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|