C12H16BrN3O3S — CID 65206601
5-amino-2-bromo-N-(2-cyanoethyl)-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 65206601) has the molecular formula C12H16BrN3O3S and a molecular weight of 362.25 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(2-cyanoethyl)-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-bromo-N-(2-cyanoethyl)-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 65206601 |
| Molecular Formula | C12H16BrN3O3S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 5-amino-2-bromo-N-(2-cyanoethyl)-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCN(CCC#N)S(=O)(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C12H16BrN3O3S/c1-19-8-7-16(6-2-5-14)20(17,18)12-9-10(15)3-4-11(12)13/h3-4,9H,2,6-8,15H2,1H3 |
| InChIKey | RJTLFDFSNICEME-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|