C11H15ClN2O3S2 — CID 103099958
5-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-4-methylthiophene-2-sulfonamide (PubChem CID 103099958) has the molecular formula C11H15ClN2O3S2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 5-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103099958 |
| Molecular Formula | C11H15ClN2O3S2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 5-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-4-methylthiophene-2-sulfonamide |
| SMILES | COCCN(CCC#N)S(=O)(=O)c1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C11H15ClN2O3S2/c1-9-8-10(18-11(9)12)19(15,16)14(5-3-4-13)6-7-17-2/h8H,3,5-7H2,1-2H3 |
| InChIKey | NAFOBYXGRTUALE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |