C12H20N2O4S2 — CID 43274039
3-N-ethyl-3-N-(2-methylpropyl)benzene-1,3-disulfonamide (PubChem CID 43274039) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-N-ethyl-3-N-(2-methylpropyl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-ethyl-3-N-(2-methylpropyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 43274039 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-N-ethyl-3-N-(2-methylpropyl)benzene-1,3-disulfonamide |
| SMILES | CCN(CC(C)C)S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H20N2O4S2/c1-4-14(9-10(2)3)20(17,18)12-7-5-6-11(8-12)19(13,15)16/h5-8,10H,4,9H2,1-3H3,(H2,13,15,16) |
| InChIKey | CBOWXYWSOPNNMF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |