C11H16N2O6S2 — CID 61008189
2-[propyl-(3-sulfamoylphenyl)sulfonylamino]acetic acid (PubChem CID 61008189) has the molecular formula C11H16N2O6S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[propyl-(3-sulfamoylphenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[propyl-(3-sulfamoylphenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 61008189 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-[propyl-(3-sulfamoylphenyl)sulfonylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H16N2O6S2/c1-2-6-13(8-11(14)15)21(18,19)10-5-3-4-9(7-10)20(12,16)17/h3-5,7H,2,6,8H2,1H3,(H,14,15)(H2,12,16,17) |
| InChIKey | XECLCAHDFXRYBN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |