C14H20N2O5S — CID 55702922
methyl 4-[(2-amino-2-oxoethyl)-butylsulfamoyl]benzoate (PubChem CID 55702922) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is methyl 4-[(2-amino-2-oxoethyl)-butylsulfamoyl]benzoate.
| Compound Name | methyl 4-[(2-amino-2-oxoethyl)-butylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 55702922 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl 4-[(2-amino-2-oxoethyl)-butylsulfamoyl]benzoate |
| SMILES | CCCCN(CC(N)=O)S(=O)(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C14H20N2O5S/c1-3-4-9-16(10-13(15)17)22(19,20)12-7-5-11(6-8-12)14(18)21-2/h5-8H,3-4,9-10H2,1-2H3,(H2,15,17) |
| InChIKey | PLBXXWRHTYQJIE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |