C12H16Br2N2O3S — CID 47318380
2-[butyl-(2,4-dibromophenyl)sulfonylamino]acetamide (PubChem CID 47318380) has the molecular formula C12H16Br2N2O3S and a molecular weight of 428.15 g/mol. Its IUPAC name is 2-[butyl-(2,4-dibromophenyl)sulfonylamino]acetamide.
| Compound Name | 2-[butyl-(2,4-dibromophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 47318380 |
| Molecular Formula | C12H16Br2N2O3S |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 425.92 |
| IUPAC Name | 2-[butyl-(2,4-dibromophenyl)sulfonylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)S(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O3S/c1-2-3-6-16(8-12(15)17)20(18,19)11-5-4-9(13)7-10(11)14/h4-5,7H,2-3,6,8H2,1H3,(H2,15,17) |
| InChIKey | PNWFBLHDNYDNEP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |