C12H15BrF2N2O3S — CID 61072716
2-[(2-bromo-4,6-difluorophenyl)sulfonyl-butylamino]acetamide (PubChem CID 61072716) has the molecular formula C12H15BrF2N2O3S and a molecular weight of 385.23 g/mol. Its IUPAC name is 2-[(2-bromo-4,6-difluorophenyl)sulfonyl-butylamino]acetamide.
| Compound Name | 2-[(2-bromo-4,6-difluorophenyl)sulfonyl-butylamino]acetamide |
|---|---|
| PubChem CID | 61072716 |
| Molecular Formula | C12H15BrF2N2O3S |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 2-[(2-bromo-4,6-difluorophenyl)sulfonyl-butylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)S(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C12H15BrF2N2O3S/c1-2-3-4-17(7-11(16)18)21(19,20)12-9(13)5-8(14)6-10(12)15/h5-6H,2-4,7H2,1H3,(H2,16,18) |
| InChIKey | LCLZXQJTTKVDHN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |