C12H14Br2N2O2S — CID 80708752
2,5-dibromo-N-(2-cyanoethyl)-N-ethyl-4-methylbenzenesulfonamide (PubChem CID 80708752) has the molecular formula C12H14Br2N2O2S and a molecular weight of 410.13 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-cyanoethyl)-N-ethyl-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(2-cyanoethyl)-N-ethyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 80708752 |
| Molecular Formula | C12H14Br2N2O2S |
| Molecular Weight | 410.13 g/mol |
| Exact Mass | 407.91 |
| IUPAC Name | 2,5-dibromo-N-(2-cyanoethyl)-N-ethyl-4-methylbenzenesulfonamide |
| SMILES | CCN(CCC#N)S(=O)(=O)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C12H14Br2N2O2S/c1-3-16(6-4-5-15)19(17,18)12-8-10(13)9(2)7-11(12)14/h7-8H,3-4,6H2,1-2H3 |
| InChIKey | SBJYERMNSGWOPD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.13 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |