C13H20ClNO4S2 — CID 79842606
5-(chloromethyl)-N,2,4-trimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 79842606) has the molecular formula C13H20ClNO4S2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 5-(chloromethyl)-N,2,4-trimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 5-(chloromethyl)-N,2,4-trimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79842606 |
| Molecular Formula | C13H20ClNO4S2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 5-(chloromethyl)-N,2,4-trimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(C)CCS(C)(=O)=O)cc1CCl |
| InChI | InChI=1S/C13H20ClNO4S2/c1-10-7-11(2)13(8-12(10)9-14)21(18,19)15(3)5-6-20(4,16)17/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | FYXCYXMEHLCTEC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|