C12H19FN2O4S2 — CID 102920881
5-fluoro-N-methyl-2-(methylaminomethyl)-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 102920881) has the molecular formula C12H19FN2O4S2 and a molecular weight of 338.43 g/mol. Its IUPAC name is 5-fluoro-N-methyl-2-(methylaminomethyl)-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 5-fluoro-N-methyl-2-(methylaminomethyl)-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102920881 |
| Molecular Formula | C12H19FN2O4S2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 5-fluoro-N-methyl-2-(methylaminomethyl)-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | CNCc1ccc(F)cc1S(=O)(=O)N(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H19FN2O4S2/c1-14-9-10-4-5-11(13)8-12(10)21(18,19)15(2)6-7-20(3,16)17/h4-5,8,14H,6-7,9H2,1-3H3 |
| InChIKey | BTDBSFFUGQGJIB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |