C13H19ClFNO2S — CID 102920022
2-(chloromethyl)-5-fluoro-N-methyl-N-pentylbenzenesulfonamide (PubChem CID 102920022) has the molecular formula C13H19ClFNO2S and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-(chloromethyl)-5-fluoro-N-methyl-N-pentylbenzenesulfonamide.
| Compound Name | 2-(chloromethyl)-5-fluoro-N-methyl-N-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 102920022 |
| Molecular Formula | C13H19ClFNO2S |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-(chloromethyl)-5-fluoro-N-methyl-N-pentylbenzenesulfonamide |
| SMILES | CCCCCN(C)S(=O)(=O)c1cc(F)ccc1CCl |
| InChI | InChI=1S/C13H19ClFNO2S/c1-3-4-5-8-16(2)19(17,18)13-9-12(15)7-6-11(13)10-14/h6-7,9H,3-5,8,10H2,1-2H3 |
| InChIKey | MRUSNEPQZOBGRK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|