C9H16N2O2S2 — CID 79019425
2-amino-N-methyl-N-(2-thiophen-2-ylethyl)ethanesulfonamide (PubChem CID 79019425) has the molecular formula C9H16N2O2S2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-amino-N-methyl-N-(2-thiophen-2-ylethyl)ethanesulfonamide.
| Compound Name | 2-amino-N-methyl-N-(2-thiophen-2-ylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 79019425 |
| Molecular Formula | C9H16N2O2S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-amino-N-methyl-N-(2-thiophen-2-ylethyl)ethanesulfonamide |
| SMILES | CN(CCc1cccs1)S(=O)(=O)CCN |
| InChI | InChI=1S/C9H16N2O2S2/c1-11(15(12,13)8-5-10)6-4-9-3-2-7-14-9/h2-3,7H,4-6,8,10H2,1H3 |
| InChIKey | IHUYSYMRAOSKGK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |