C14H16ClNO2S2 — CID 110733491
1-(2-chlorophenyl)-N-methyl-N-(2-thiophen-2-ylethyl)methanesulfonamide (PubChem CID 110733491) has the molecular formula C14H16ClNO2S2 and a molecular weight of 329.87 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-methyl-N-(2-thiophen-2-ylethyl)methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-methyl-N-(2-thiophen-2-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 110733491 |
| Molecular Formula | C14H16ClNO2S2 |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 1-(2-chlorophenyl)-N-methyl-N-(2-thiophen-2-ylethyl)methanesulfonamide |
| SMILES | CN(CCc1cccs1)S(=O)(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C14H16ClNO2S2/c1-16(9-8-13-6-4-10-19-13)20(17,18)11-12-5-2-3-7-14(12)15/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | GNQFNYCLEPDUGJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |