C10H15NO4S2 — CID 79019132
3-[methyl(2-thiophen-2-ylethyl)sulfamoyl]propanoic acid (PubChem CID 79019132) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-[methyl(2-thiophen-2-ylethyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[methyl(2-thiophen-2-ylethyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 79019132 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 3-[methyl(2-thiophen-2-ylethyl)sulfamoyl]propanoic acid |
| SMILES | CN(CCc1cccs1)S(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C10H15NO4S2/c1-11(6-4-9-3-2-7-16-9)17(14,15)8-5-10(12)13/h2-3,7H,4-6,8H2,1H3,(H,12,13) |
| InChIKey | ZFJASUSTFGDQAV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |