C13H15NO5S2 — CID 60952712
3-[furan-2-ylmethyl(thiophen-2-ylmethyl)sulfamoyl]propanoic acid (PubChem CID 60952712) has the molecular formula C13H15NO5S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[furan-2-ylmethyl(thiophen-2-ylmethyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[furan-2-ylmethyl(thiophen-2-ylmethyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 60952712 |
| Molecular Formula | C13H15NO5S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3-[furan-2-ylmethyl(thiophen-2-ylmethyl)sulfamoyl]propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)N(Cc1ccco1)Cc1cccs1 |
| InChI | InChI=1S/C13H15NO5S2/c15-13(16)5-8-21(17,18)14(9-11-3-1-6-19-11)10-12-4-2-7-20-12/h1-4,6-7H,5,8-10H2,(H,15,16) |
| InChIKey | UCYWHVFQBJMIMM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |