C17H17NO2S2 — CID 52556210
3-(furan-2-yl)-N,N-bis(thiophen-2-ylmethyl)propanamide (PubChem CID 52556210) has the molecular formula C17H17NO2S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-(furan-2-yl)-N,N-bis(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-(furan-2-yl)-N,N-bis(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 52556210 |
| Molecular Formula | C17H17NO2S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 3-(furan-2-yl)-N,N-bis(thiophen-2-ylmethyl)propanamide |
| SMILES | O=C(CCc1ccco1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C17H17NO2S2/c19-17(8-7-14-4-1-9-20-14)18(12-15-5-2-10-21-15)13-16-6-3-11-22-16/h1-6,9-11H,7-8,12-13H2 |
| InChIKey | FAGQFVJUWCEOFE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |