C20H20BrNO3S — CID 31836568
3-(3-bromo-4-methoxyphenyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 31836568) has the molecular formula C20H20BrNO3S and a molecular weight of 434.36 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 31836568 |
| Molecular Formula | C20H20BrNO3S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-N-(furan-2-ylmethyl)-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | COc1ccc(CCC(=O)N(Cc2ccco2)Cc2cccs2)cc1Br |
| InChI | InChI=1S/C20H20BrNO3S/c1-24-19-8-6-15(12-18(19)21)7-9-20(23)22(13-16-4-2-10-25-16)14-17-5-3-11-26-17/h2-6,8,10-12H,7,9,13-14H2,1H3 |
| InChIKey | IDPDMEHXUMRDOC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |