C16H18BrNO4 — CID 23996130
3-[(3-bromo-4-methoxyphenyl)methyl-(furan-2-ylmethyl)amino]propanoic acid (PubChem CID 23996130) has the molecular formula C16H18BrNO4 and a molecular weight of 368.23 g/mol. Its IUPAC name is 3-[(3-bromo-4-methoxyphenyl)methyl-(furan-2-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[(3-bromo-4-methoxyphenyl)methyl-(furan-2-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 23996130 |
| Molecular Formula | C16H18BrNO4 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 3-[(3-bromo-4-methoxyphenyl)methyl-(furan-2-ylmethyl)amino]propanoic acid |
| SMILES | COc1ccc(CN(CCC(=O)O)Cc2ccco2)cc1Br |
| InChI | InChI=1S/C16H18BrNO4/c1-21-15-5-4-12(9-14(15)17)10-18(7-6-16(19)20)11-13-3-2-8-22-13/h2-5,8-9H,6-7,10-11H2,1H3,(H,19,20) |
| InChIKey | WEYALBMDAQDBIH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |