C15H17BrO3 — CID 105082155
1-(3-bromo-4-methoxyphenyl)-4-(furan-2-yl)butan-2-ol (PubChem CID 105082155) has the molecular formula C15H17BrO3 and a molecular weight of 325.20 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-4-(furan-2-yl)butan-2-ol.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-4-(furan-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 105082155 |
| Molecular Formula | C15H17BrO3 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-4-(furan-2-yl)butan-2-ol |
| SMILES | COc1ccc(CC(O)CCc2ccco2)cc1Br |
| InChI | InChI=1S/C15H17BrO3/c1-18-15-7-4-11(10-14(15)16)9-12(17)5-6-13-3-2-8-19-13/h2-4,7-8,10,12,17H,5-6,9H2,1H3 |
| InChIKey | GJAWWKHWQFNSRB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |